CymitQuimica logo

CAS 114080-96-5

:

3-Bromo-N-hydroxy-2-pyridinecarboximidamide

Description:
3-Bromo-N-hydroxy-2-pyridinecarboximidamide is a chemical compound characterized by its unique structure, which includes a bromine atom, a hydroxyl group, and a pyridine ring. The presence of the bromine substituent indicates potential reactivity, particularly in nucleophilic substitution reactions. The hydroxyl group contributes to the compound's ability to form hydrogen bonds, enhancing its solubility in polar solvents. As a carboximidamide, it features an amidine functional group, which is known for its basicity and ability to act as a ligand in coordination chemistry. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 3-Bromo-N-hydroxy-2-pyridinecarboximidamide represents a versatile structure with potential applications in various chemical and pharmaceutical fields.
Formula:C6H6BrN3O
InChI:InChI=1S/C6H6BrN3O/c7-4-2-1-3-9-5(4)6(8)10-11/h1-3,11H,(H2,8,10)
InChI key:InChIKey=WRMYTEBMZPWCDF-UHFFFAOYSA-N
SMILES:C(NO)(=N)C1=C(Br)C=CC=N1
Synonyms:
  • 3-Bromo-N′-hydroxypyridine-2-carboximidamide
  • 3-Bromo-N-hydroxy-2-pyridinecarboximidamide
  • 2-Pyridinecarboximidamide, 3-bromo-N-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.