CAS 114084-97-8
:2-(Diethylamino)-6-phenyl-4-(trifluoromethyl)-3-pyridinecarbonitrile
Description:
2-(Diethylamino)-6-phenyl-4-(trifluoromethyl)-3-pyridinecarbonitrile, with the CAS number 114084-97-8, is a chemical compound characterized by its complex structure that includes a pyridine ring substituted with a diethylamino group, a phenyl group, and a trifluoromethyl group, along with a cyano group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the cyano group. The trifluoromethyl group enhances lipophilicity and can influence the compound's electronic properties, making it of interest in medicinal chemistry and material science. Its diethylamino substituent may impart basic characteristics, allowing for interactions with various biological targets. The presence of multiple functional groups suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's unique structure may contribute to its solubility and reactivity in various solvents, making it a candidate for further research in synthetic and applied chemistry.
Formula:C17H16F3N3
InChI:InChI=1S/C17H16F3N3/c1-3-23(4-2)16-13(11-21)14(17(18,19)20)10-15(22-16)12-8-6-5-7-9-12/h5-10H,3-4H2,1-2H3
InChI key:InChIKey=KFYGEAREIUYUMI-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1=C(C#N)C(C(F)(F)F)=CC(=N1)C2=CC=CC=C2
Synonyms:- 2-(Diethylamino)-6-phenyl-4-(trifluoromethyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 2-(diethylamino)-6-phenyl-4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Diethylamino)-6-phenyl-4-(trifluoromethyl)nicotinonitrile
CAS:Formula:C17H16F3N3Molecular weight:319.3242
