
CAS 1141-05-5
:1,2-Di-2-pyridinyl-1,2-ethanediol
Description:
1,2-Di-2-pyridinyl-1,2-ethanediol, with the CAS number 1141-05-5, is an organic compound characterized by its dual pyridine rings and hydroxyl functional groups. This compound features a central ethanediol backbone, where each carbon atom is substituted with a pyridinyl group, contributing to its aromatic properties. The presence of hydroxyl (-OH) groups enhances its solubility in polar solvents and allows for potential hydrogen bonding interactions. Typically, compounds of this nature exhibit interesting chemical reactivity, including the ability to form coordination complexes with metal ions due to the nitrogen atoms in the pyridine rings. Additionally, the structural configuration can influence its biological activity, making it a subject of interest in medicinal chemistry. The compound may also display unique optical properties due to its chiral centers, which can lead to enantiomeric forms with different biological effects. Overall, 1,2-Di-2-pyridinyl-1,2-ethanediol is a versatile compound with applications in various fields, including pharmaceuticals and materials science.
Formula:C12H12N2O2
InChI:InChI=1S/C12H12N2O2/c15-11(9-5-1-3-7-13-9)12(16)10-6-2-4-8-14-10/h1-8,11-12,15-16H
InChI key:InChIKey=HVIBJFDEUPZPPC-UHFFFAOYSA-N
SMILES:C(C(O)C1=CC=CC=N1)(O)C2=CC=CC=N2
Synonyms:- 1,2-Ethanediol, 1,2-di-2-pyridinyl-
- 1,2-Ethanediol, 1,2-di-2-pyridyl-
- 1,2-Di-2-pyridinyl-1,2-ethanediol
- NSC 16409
- 1,2-Di-2-pyridylglycol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
α-Pyridoin
CAS:<p>α-Pyridoin (α-pyridoin) is an enediol (enediol) compound that acts as a unique antioxidant.</p>Formula:C12H12N2O2Color and Shape:SolidMolecular weight:216.24

