
CAS 1141-29-3
:3′-Nitro[1,1′-biphenyl]-4-amine
Description:
3′-Nitro[1,1′-biphenyl]-4-amine, with the CAS number 1141-29-3, is an organic compound characterized by the presence of a nitro group (-NO2) and an amino group (-NH2) attached to a biphenyl structure. This compound typically appears as a solid and is known for its aromatic properties due to the biphenyl framework, which consists of two phenyl rings connected by a single bond. The nitro group is a strong electron-withdrawing group, which can influence the compound's reactivity and stability, while the amino group can act as a nucleophile in various chemical reactions. This substance is often utilized in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. Its properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. As with many nitro and amino compounds, it is essential to handle it with care due to potential toxicity and environmental impact.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c13-11-6-4-9(5-7-11)10-2-1-3-12(8-10)14(15)16/h1-8H,13H2
InChI key:InChIKey=UIPWYSFUWRTDOG-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1)C2=CC=C(N)C=C2
Synonyms:- 4-Amino-3′-nitrobiphenyl
- 3′-Nitro[1,1′-biphenyl]-4-amine
- 4-Biphenylamine, 3′-nitro-
- [1,1′-Biphenyl]-4-amine, 3′-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
