CAS 1141-38-4: 2,6-Naphthalenedicarboxylic acid
Description:2,6-Naphthalenedicarboxylic acid, with the CAS number 1141-38-4, is an aromatic dicarboxylic acid characterized by its two carboxyl (-COOH) functional groups attached to a naphthalene ring at the 2 and 6 positions. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. It has a relatively high melting point, indicative of strong intermolecular interactions, including hydrogen bonding. 2,6-Naphthalenedicarboxylic acid is used in various applications, including the synthesis of polyesters and as a precursor for other chemical compounds. Its structure allows for potential applications in the production of high-performance materials, including polymers and resins. Additionally, it exhibits properties that may be beneficial in the field of organic electronics and as a building block in organic synthesis. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation to skin and eyes.
Formula:C12H8O4
InChI:InChI=1S/C12H8O4/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9/h1-6H,(H,13,14)(H,15,16)
InChI key:InChIKey=RXOHFPCZGPKIRD-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=CC2=CC(=CC=C2C1)C(=O)O
- Synonyms:
- 2,6-Naphthalenedicarboxylic acid
- Naphthalene-2,6-Dicarboxylate
- 2,6-Naphthalene dicarboxylic acid
- 2,6-Naphthalic acid
- Acide naphtalene-2,6-dicarboxylique
- Acido Naftaleno-2,6-Dicarboxilico
- Naphthalin-2,6-dicarbonsaure
- Nsc 96410
