CymitQuimica logo

CAS 1141-45-3

:

3-(2-Naphthylthio)propionic acid

Description:
3-(2-Naphthylthio)propionic acid, with the CAS number 1141-45-3, is an organic compound characterized by its structure, which includes a propionic acid moiety attached to a 2-naphthylthio group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, though its solubility in water is limited. The presence of the naphthyl group contributes to its aromatic properties, which can influence its reactivity and interactions in various chemical environments. As a carboxylic acid, it exhibits acidic behavior, capable of donating protons in solution. This compound may be utilized in various chemical syntheses and research applications, particularly in the fields of medicinal chemistry and organic synthesis. Its unique structure allows for potential applications in drug development and as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H12O2S
InChI:InChI=1/C13H12O2S/c14-13(15)7-8-16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,7-8H2,(H,14,15)
SMILES:c1ccc2cc(ccc2c1)SCCC(=O)O
Synonyms:
  • 3-(2-Naphthylmercapto)propionic acid
  • 3-(Naphthalen-2-Ylsulfanyl)Propanoic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.