CAS 114108-90-6
:(4-CHLORO-2-FLUORO-PHENYL)-CARBAMIC ACID ETHYL ESTER
Description:
(4-Chloro-2-fluoro-phenyl)-carbamic acid ethyl ester, with the CAS number 114108-90-6, is an organic compound characterized by its carbamate functional group. This compound features a phenyl ring substituted with both a chlorine atom at the para position and a fluorine atom at the ortho position, which can influence its reactivity and biological activity. The ethyl ester moiety contributes to its solubility and potential applications in various chemical reactions. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity, which can affect their absorption and distribution in biological systems. Additionally, the presence of halogen substituents often enhances the compound's stability and can impart unique pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals, due to its potential biological activity. As with many chemical substances, safety and handling precautions should be observed, given the possible toxicity associated with halogenated compounds.
Formula:C9H9ClFNO2
InChI:InChI=1/C9H9ClFNO2/c1-2-14-9(13)12-8-4-3-6(10)5-7(8)11/h3-5H,2H2,1H3,(H,12,13)
SMILES:CCOC(=Nc1ccc(cc1F)Cl)O
Synonyms:- (4-Fluoro-2-fluoro-phenyl)-carbamic acid ethyl ester
- Ethyl 4-Chloro-2-Fluorophenylcarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Carbamic acid, N-(4-chloro-2-fluorophenyl)-, ethyl ester
CAS:Formula:C9H9ClFNO2Molecular weight:217.6247
