
CAS 114109-54-5
:5-Amino-2,4-dimethoxyphenol
Description:
5-Amino-2,4-dimethoxyphenol is an organic compound characterized by the presence of an amino group and two methoxy groups attached to a phenolic structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its aromatic nature. The amino group (-NH2) contributes to its basicity and potential reactivity, while the methoxy groups (-OCH3) enhance its solubility in organic solvents and influence its electronic properties. This compound is often utilized in various applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. Its phenolic structure may also impart antioxidant properties, making it of interest in biochemical research. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 5-Amino-2,4-dimethoxyphenol is a versatile compound with significant implications in both industrial and research settings.
Formula:C8H11NO3
InChI:InChI=1S/C8H11NO3/c1-11-7-4-8(12-2)6(10)3-5(7)9/h3-4,10H,9H2,1-2H3
InChI key:InChIKey=CQPLGGXOAHSQBD-UHFFFAOYSA-N
SMILES:O(C)C1=CC(OC)=C(O)C=C1N
Synonyms:- Phenol, 5-amino-2,4-dimethoxy-
- 5-Amino-2,4-dimethoxyphenol
- 4,6-Dimethoxy-3-amino-1-hydroxybenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
