CymitQuimica logo

CAS 114117-71-4

:

L-Leucinamide, N-[(1,1-dimethylethoxy)carbonyl]-L-alanyl-N-methyl-

Description:
L-Leucinamide, N-[(1,1-dimethylethoxy)carbonyl]-L-alanyl-N-methyl- is a synthetic compound that belongs to the class of amino acid derivatives. It features a leucine moiety, which is an essential branched-chain amino acid, and is modified with a protective group, specifically a tert-butoxycarbonyl (Boc) group, which is commonly used in peptide synthesis to protect amino groups. The presence of the N-methyl group indicates that it has a methyl substitution on the nitrogen atom, which can influence its biological activity and solubility. This compound may be utilized in various biochemical applications, including peptide synthesis and drug development, due to its structural characteristics that can facilitate interactions with biological targets. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. As with many amino acid derivatives, it may exhibit specific biological activities, making it of interest in pharmacological research.
Formula:C15H29N3O4
InChI:InChI=1S/C15H29N3O4/c1-9(2)8-11(13(20)16-7)18-12(19)10(3)17-14(21)22-15(4,5)6/h9-11H,8H2,1-7H3,(H,16,20)(H,17,21)(H,18,19)/t10-,11-/m0/s1
InChI key:InChIKey=IGWYMHUHOFTZDZ-QWRGUYRKSA-N
SMILES:[C@@H](NC([C@@H](NC(OC(C)(C)C)=O)C)=O)(C(NC)=O)CC(C)C
Synonyms:
  • L-Leucinamide, N-[(1,1-dimethylethoxy)carbonyl]-L-alanyl-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.