CymitQuimica logo

CAS 114119-87-8

:

Fmoc-Gly-ODhbt

Description:
Fmoc-Gly-ODhbt, with the CAS number 114119-87-8, is a chemical compound commonly used in peptide synthesis and research. It features a phenylmethoxycarbonyl (Fmoc) protecting group attached to glycine (Gly), which is an amino acid. The Fmoc group is widely utilized in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal under mild acidic conditions. The presence of the ODhbt moiety indicates that it may also possess specific functionalities that enhance its reactivity or solubility in certain solvents. This compound is typically characterized by its solid-state form, and its purity and identity can be confirmed through techniques such as high-performance liquid chromatography (HPLC) and nuclear magnetic resonance (NMR) spectroscopy. Fmoc-Gly-ODhbt is valuable in the synthesis of peptides and other biomolecules, facilitating the study of protein interactions and functions in biochemical research. Its stability and reactivity make it a useful tool in the field of organic and medicinal chemistry.
Formula:C24H18N4O5
InChI:InChI=1S/C24H18N4O5/c29-22(33-28-23(30)19-11-5-6-12-21(19)26-27-28)13-25-24(31)32-14-20-17-9-3-1-7-15(17)16-8-2-4-10-18(16)20/h1-12,20H,13-14H2,(H,25,31)
InChI key:ABEAVVDFOQEIDM-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)ON4C(=O)C5=CC=CC=C5N=N4
Found 0 products.