
CAS 114119-97-0
:2,5,7,7-Tetramethyloctanal
Description:
2,5,7,7-Tetramethyloctanal is an organic compound classified as an aldehyde, characterized by its long carbon chain and multiple methyl substituents. It features a straight-chain octanal backbone with four methyl groups located at the 2, 5, and 7 positions, contributing to its branched structure. This compound is typically a colorless to pale yellow liquid at room temperature and possesses a distinctive odor, characteristic of aldehydes. Its molecular structure imparts certain physical properties, such as a relatively low boiling point compared to more complex aldehydes, and it is likely to be less soluble in water due to its hydrophobic alkyl chains. 2,5,7,7-Tetramethyloctanal may be used in various applications, including fragrance formulations and as an intermediate in organic synthesis. As with many aldehydes, it may exhibit reactivity towards nucleophiles and can participate in various chemical reactions, including oxidation and condensation. Safety precautions should be taken when handling this compound, as aldehydes can be irritants and potentially harmful in concentrated forms.
Formula:C12H24O
InChI:InChI=1S/C12H24O/c1-10(8-12(3,4)5)6-7-11(2)9-13/h9-11H,6-8H2,1-5H3
InChI key:InChIKey=HZAYXCABCQOHLC-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)C(CCC(C=O)C)C
Synonyms:- 2,5,7,7-Tetramethyloctanal
- Octanal, 2,5,7,7-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,5,7,7-Tetramethyloctanal
CAS:2,5,7,7-Tetramethyloctanal is a bioactive chemical.Formula:C12H24OColor and Shape:LiquidMolecular weight:184.32

