CAS 114133-37-8
:(S)-3-(Methylamino)-1-phenylpropan-1-ol
Description:
(S)-3-(Methylamino)-1-phenylpropan-1-ol, with the CAS number 114133-37-8, is a chiral organic compound characterized by its amine and alcohol functional groups. This substance features a phenyl group attached to a propanol backbone, with a methylamino group at the third carbon position. Its chirality indicates that it exists in two enantiomeric forms, with the (S)-configuration being one of them, which can influence its biological activity and interactions. The compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group. It may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or other organic compounds. The presence of both amine and alcohol functionalities allows for various chemical reactions, including alkylation and acylation. As with many amines, it may also exhibit basic properties, making it relevant in various chemical and biological contexts. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H15NO
InChI:InChI=1/C10H15NO/c1-11-8-7-10(12)9-5-3-2-4-6-9/h2-6,10-12H,7-8H2,1H3/t10-/m0/s1
Synonyms:- Atomoxetine intermediate
- (S)-3-(Methylamino)-1-Phenyl-1-Propanol
- (1S)-3-(methylamino)-1-phenylpropan-1-ol
- Benzenemethanol, α-[2-(methylamino)ethyl]-, (αS)- (R)
- (S)-N-Methyl-3-phenyl-3-hydroxypropylamine
- N-Methyl((S)-3-hydroxy-3-phenylpropyl)amine
- (s)-3-(methylamino)-1-phenylpropanol (114133-37-8)
- (S)-3-(MethylaMino)-1-phenylpropan-1-ol 
- Atomoxetine EP Impurity H (S-Isomer)
- (S)-3-(METHYLAMINO)-1-PHENYLPROPANOL
- (S)-N-Methyl-3-ol-3-phenylpropanamine
- Atomoxetine Impurity 23
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenemethanol, α-[2-(methylamino)ethyl]-, (αS)-
CAS:Formula:C10H15NOPurity:95%Color and Shape:SolidMolecular weight:165.2322(S)-3-(Methylamino)-1-phenylpropan-1-ol
CAS:(S)-3-(Methylamino)-1-phenylpropan-1-olPurity:97%Molecular weight:165.24g/molAtomoxetine EP Impurity H (S-Isomer)
CAS:Formula:C10H15NOColor and Shape:White To Off-White SolidMolecular weight:165.24



