CAS 114138-50-0
:5-Hydroxy-1-phenyl-1H-pyrazole-3-carboxylic acid
Description:
5-Hydroxy-1-phenyl-1H-pyrazole-3-carboxylic acid, with the CAS number 114138-50-0, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) that contribute to its acidic properties and potential for hydrogen bonding. The presence of the phenyl group enhances its aromatic characteristics and may influence its solubility and reactivity. Typically, compounds like this can exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests that it may participate in various chemical reactions, including esterification and amidation, due to the functional groups present. Additionally, its solubility in polar solvents is likely due to the hydroxyl and carboxylic acid functionalities. Overall, 5-Hydroxy-1-phenyl-1H-pyrazole-3-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C10H8N2O3
InChI:InChI=1S/C10H8N2O3/c13-9-6-8(10(14)15)11-12(9)7-4-2-1-3-5-7/h1-6,13H,(H,14,15)
InChI key:InChIKey=LRSZONKWTDEUSM-UHFFFAOYSA-N
SMILES:OC=1N(N=C(C(O)=O)C1)C2=CC=CC=C2
Synonyms:- 5-Hydroxy-1-phenyl-1H-pyrazole-3-carboxylic acid
- 1H-Pyrazole-3-carboxylic acid, 5-hydroxy-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
