CAS 114143-76-9
:1-(1-Butyn-1-yl)-2-methylpyrrolidine
Description:
1-(1-Butyn-1-yl)-2-methylpyrrolidine is an organic compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a butynyl group and a methyl group. This compound features a five-membered nitrogen-containing heterocycle, which contributes to its potential reactivity and interaction with biological systems. The presence of the butynyl group introduces a triple bond, making it a valuable intermediate in organic synthesis and potentially influencing its physical properties, such as boiling and melting points. The methyl group enhances the steric bulk around the nitrogen atom, which may affect the compound's solubility and reactivity. Generally, compounds of this nature can exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature, solvent, and the presence of other functional groups. Overall, 1-(1-Butyn-1-yl)-2-methylpyrrolidine represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.
Formula:C9H15N
InChI:InChI=1S/C9H15N/c1-3-4-7-10-8-5-6-9(10)2/h9H,3,5-6,8H2,1-2H3
InChI key:InChIKey=SGVAWWQBFHRJIM-UHFFFAOYSA-N
SMILES:C(#CCC)N1C(C)CCC1
Synonyms:- Pyrrolidine, 1-(1-butynyl)-2-methyl-
- Pyrrolidine, 1-(1-butyn-1-yl)-2-methyl-
- 1-(1-Butyn-1-yl)-2-methylpyrrolidine
- Pyrrolidine, 1-(1-butynyl)-2-methyl-, (±)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
