CymitQuimica logo

CAS 114144-17-1

:

5-Iodo-1H-indole-3-carboxaldehyde

Description:
5-Iodo-1H-indole-3-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of an aldehyde functional group at the 3-position and an iodine atom at the 5-position distinguishes this compound. It typically appears as a solid or crystalline substance and is known for its reactivity due to the aldehyde group, which can participate in various chemical reactions, including condensation and oxidation. This compound is of interest in organic synthesis and medicinal chemistry, particularly for its potential applications in the development of pharmaceuticals and agrochemicals. Its iodine substituent can also enhance biological activity and influence the compound's electronic properties. As with many indole derivatives, 5-Iodo-1H-indole-3-carboxaldehyde may exhibit interesting biological activities, making it a subject of research in various fields, including biochemistry and drug discovery. Proper handling and safety measures should be observed due to its chemical reactivity and potential hazards.
Formula:C9H6INO
InChI:InChI=1S/C9H6INO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H
InChI key:InChIKey=UTEGGIRVAHNXDS-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=CC=C(I)C2
Synonyms:
  • 5-Iodo-3-indolecarboxaldehyde
  • 1H-Indole-3-carboxaldehyde, 5-iodo-
  • 5-Iodo-1H-indole-3-carboxaldehyde
Found 4 products.