CAS 114150-42-4

5-(4-Chlorophenyl)-1-(4-methoxyphenyl)-1H-pyrazole-3-propanoic acid

Description:

5-(4-Chlorophenyl)-1-(4-methoxyphenyl)-1H-pyrazole-3-propanoic acid, with the CAS number 114150-42-4, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a propanoic acid functional group, contributing to its acidic properties. The presence of a 4-chlorophenyl group and a 4-methoxyphenyl group enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their potential pharmacological applications, including anti-inflammatory or analgesic effects. The molecular structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine and the potential for biological activity.

Formula: C₁₉H₁₇ClN₂O₃

InChI: InChI=1S/C19H17ClN2O3/c1-25-17-9-7-16(8-10-17)22-18(13-2-4-14(20)5-3-13)12-15(21-22)6-11-19(23)24/h2-5,7-10,12H,6,11H2,1H3,(H,23,24)

InChI key: InChIKey=JWWITSKUTWOSQS-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=NN(C(=C1)C2=CC=C(Cl)C=C2)C3=CC=C(OC)C=C3

Synonyms:

• 5-(4-Chlorophenyl)-1-(4-methoxyphenyl)-1H-pyrazole-3-propanoic acid
• 1H-Pyrazole-3-propanoic acid, 5-(4-chlorophenyl)-1-(4-methoxyphenyl)-
• RWJ 20142

3-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-1H-pyrazol-3-yl]propanoic acid

CAS: 114150-42-4

Formula: C₁₉H₁₇ClN₂O₃

Molecular weight: 356.8029

Ref: IN-DA000AOD