
CAS 114152-24-8
:2,3,6-Trifluorobenzeneethanol
Description:
2,3,6-Trifluorobenzeneethanol, with the CAS number 114152-24-8, is an organic compound characterized by the presence of a benzene ring substituted with three fluorine atoms and a hydroxyl group (–OH) attached to an ethyl chain. This compound exhibits properties typical of both aromatic and alcohol functionalities. The trifluoromethyl groups contribute to its unique reactivity and polarity, influencing its solubility in various solvents and its interaction with biological systems. The presence of fluorine atoms often enhances the compound's stability and lipophilicity, making it of interest in pharmaceutical and agrochemical applications. Additionally, the hydroxyl group imparts hydrogen-bonding capabilities, which can affect its boiling point and melting point compared to non-hydroxylated analogs. Overall, 2,3,6-Trifluorobenzeneethanol is a versatile compound with potential applications in synthesis and material science, although specific reactivity and stability would depend on the surrounding conditions and the presence of other functional groups.
Formula:C8H7F3O
InChI:InChI=1S/C8H7F3O/c9-6-1-2-7(10)8(11)5(6)3-4-12/h1-2,12H,3-4H2
InChI key:InChIKey=OVLNHUHKVMDBNI-UHFFFAOYSA-N
SMILES:C(CO)C1=C(F)C(F)=CC=C1F
Synonyms:- 2,3,6-Trifluorobenzeneethanol
- 2-(2,3,6-Trifluorophenyl)ethan-1-ol
- 2-(2,3,6-Trifluorophenyl)ethyl alcohol
- 2-(2,3,6-Trifluorophenyl)ethanol
- Benzeneethanol, 2,3,6-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.