CAS 114165-30-9

N-Acetyl-5-bromo-3-hydroxyindole

Description:

N-Acetyl-5-bromo-3-hydroxyindole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 5-position and a hydroxy group at the 3-position contributes to its unique reactivity and potential biological activity. The acetyl group at the nitrogen atom enhances its solubility and stability, making it suitable for various applications in organic synthesis and medicinal chemistry. This compound may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects would depend on further research. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₁₀H₈BrNO₂

InChI: InChI=1/C10H8BrNO2/c1-6(13)12-5-10(14)8-4-7(11)2-3-9(8)12/h2-5,14H,1H3

SMILES: CC(=O)n1cc(c2cc(ccc12)Br)O

Synonyms:

• 1-Acetyl-5-bromoindol-3-ol
• 1-Acetyl-5-bromoindoxyl
• 1-acetyl-5-bromo-1H-indol-3-ol

N-Acetyl-5-bromo-3-hydroxyindole

CAS: 114165-30-9

Formula: C₁₀H₈BrNO₂

Molecular weight: 254.0800

Ref: IN-DA000AOY

1-Acetyl-5-bromo-3-hydroxy-1H-indole

CAS: 114165-30-9

1-Acetyl-5-bromo-3-hydroxy-1H-indole

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 254.08g/mol

Ref: 54-OR4554

5-Bromo-3-indoxyl-1-acetate

CAS: 114165-30-9

5-Bromo-3-indoxyl-1-acetate is a chemical compound that belongs to the group of bromonitriles. It can be used as a reactive building block in the synthesis of other compounds, such as pharmaceuticals and agrochemicals. 5-Bromo-3-indoxyl-1-acetate is also used as a reagent for research purposes, such as protein labeling.

Formula: C₁₀H₈BrNO₂

Molecular weight: 254.09 g/mol

Ref: 3D-B-8800

1-Acetyl-5-bromoindol-3-ol

CAS: 114165-30-9

Please enquire for more information about 1-Acetyl-5-bromoindol-3-ol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₈BrNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 254.08 g/mol

Ref: 3D-FA30362

N-Acetyl-5-bromo-3-hydroxyindole

CAS: 114165-30-9

N-Acetyl-5-bromo-3-hydroxyindole is a fine chemical that is used as a versatile building block, useful intermediate, and reaction component.

Formula: C₁₀H₈BrNO₂

Purity: Min. 98.5 Area-%

Molecular weight: 254.09 g/mol

Ref: 3D-A-0620