CymitQuimica logo

CAS 1141669-67-1

:

Ethyl 6,7-dihydro-4H-pyrano[4,3-d]thiazole-2-carboxylate

Description:
Ethyl 6,7-dihydro-4H-pyrano[4,3-d]thiazole-2-carboxylate is a heterocyclic compound characterized by its unique pyranothiazole structure, which combines elements of both pyran and thiazole rings. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of functional groups such as the carboxylate ester. The thiazole moiety contributes to its biological activity, making it of interest in medicinal chemistry for potential pharmacological applications. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the ethyl ester group can influence its lipophilicity and bioavailability, which are critical factors in drug design. Overall, this compound represents a class of organic molecules that may have significant implications in synthetic chemistry and drug development, although specific applications would depend on further research and characterization.
Formula:C9H11NO3S
InChI:InChI=1S/C9H11NO3S/c1-2-13-9(11)8-10-6-3-4-12-5-7(6)14-8/h2-5H2,1H3
InChI key:InChIKey=CPRPFOXYISGJAU-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC2=C(S1)COCC2
Synonyms:
  • Ethyl 6,7-dihydro-4H-pyrano[4,3-d]thiazole-2-carboxylate
  • 4H-Pyrano[4,3-d]thiazole-2-carboxylic acid, 6,7-dihydro-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.