CAS 1141669-79-5

5-Cyclopropyl-1H-imidazol-2-amine

Description:

5-Cyclopropyl-1H-imidazol-2-amine is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a cyclopropyl group at the 5-position of the imidazole ring contributes to its unique properties, including potential steric effects and reactivity. This compound is classified as an amine due to the amino group (-NH2) located at the 2-position of the imidazole, which can participate in hydrogen bonding and influence its solubility and reactivity in various chemical environments. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for interactions with biological targets, potentially leading to therapeutic applications. Additionally, the compound's stability, reactivity, and solubility can be influenced by the presence of the cyclopropyl group, which may affect its pharmacokinetic properties. Overall, 5-Cyclopropyl-1H-imidazol-2-amine presents a fascinating subject for further research in both synthetic and medicinal chemistry.

Formula: C₆H₉N₃

InChI: InChI=1S/C6H9N3/c7-6-8-3-5(9-6)4-1-2-4/h3-4H,1-2H2,(H3,7,8,9)

InChI key: InChIKey=LHDVWRMWQJIACV-UHFFFAOYSA-N

SMILES: NC=1NC(C2CC2)=CN1

Synonyms:

• 2-Amino-4-cyclopropylimidazole
• 1H-Imidazol-2-amine, 5-cyclopropyl-
• 5-Cyclopropyl-1H-imidazol-2-amine