
CAS 1141669-83-1
:Ethyl 1,2-dihydro-2-oxo-4-quinazolinecarboxylate
Description:
Ethyl 1,2-dihydro-2-oxo-4-quinazolinecarboxylate is a chemical compound characterized by its quinazoline structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features a carboxylate ester functional group, which contributes to its reactivity and solubility properties. The presence of the 1,2-dihydro-2-oxo moiety indicates that it has a carbonyl group adjacent to a saturated carbon, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Ethyl 1,2-dihydro-2-oxo-4-quinazolinecarboxylate is of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or anticancer properties. Its synthesis typically involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many quinazoline derivatives, it may serve as a scaffold for the development of new pharmaceuticals.
Formula:C11H10N2O3
InChI:InChI=1S/C11H10N2O3/c1-2-16-10(14)9-7-5-3-4-6-8(7)12-11(15)13-9/h3-6H,2H2,1H3,(H,12,13,15)
InChI key:InChIKey=ZCOAEEBYAKLDMI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NC(=O)N1)=CC=CC2
Synonyms:- 4-Quinazolinecarboxylic acid, 1,2-dihydro-2-oxo-, ethyl ester
- Ethyl 1,2-dihydro-2-oxo-4-quinazolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.