CAS 1141826-57-4

(3R)-1-Ethyl-3-piperidinecarboxylic acid

Description:

(3R)-1-Ethyl-3-piperidinecarboxylic acid is a chiral compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of the ethyl group at the 1-position and the carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. Its chirality, denoted by the (3R) configuration, indicates that it has specific stereochemical properties that can influence its biological activity and interactions. As a piperidine derivative, it may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound's stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature, making it an interesting subject for further research in both synthetic and applied chemistry.

Formula: C₈H₁₅NO₂

InChI: InChI=1S/C8H15NO2/c1-2-9-5-3-4-7(6-9)8(10)11/h7H,2-6H2,1H3,(H,10,11)/t7-/m1/s1

InChI key: InChIKey=AUAARCSKNLPQTM-SSDOTTSWSA-N

SMILES: C(O)(=O)[C@H]1CN(CC)CCC1

Synonyms:

• (3R)-1-Ethyl-3-piperidinecarboxylic acid
• (3R)-1-Ethylpiperidine-3-carboxylic acid
• 3-Piperidinecarboxylic acid, 1-ethyl-, (3R)-