CAS 1141878-45-6
:[1-(Tetrahydro-2H-pyran-2-yl)-3-(trifluoromethyl)-1H-pyrazol-5-yl]boronic acid
Description:
[1-(Tetrahydro-2H-pyran-2-yl)-3-(trifluoromethyl)-1H-pyrazol-5-yl]boronic acid is a boronic acid derivative characterized by its unique structural features, including a pyrazole ring and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The presence of the boronic acid functional group allows for potential applications in drug development, particularly in the design of inhibitors for enzymes like proteases and kinases. Additionally, the compound may exhibit interesting reactivity patterns due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its stability and interaction with other chemical species. Overall, this compound represents a versatile building block in the synthesis of more complex molecules in pharmaceutical research.
Formula:C9H12BF3N2O3
InChI:InChI=1S/C9H12BF3N2O3/c11-9(12,13)6-5-7(10(16)17)15(14-6)8-3-1-2-4-18-8/h5,8,16-17H,1-4H2
SMILES:C1CCOC(C1)n1c(cc(C(F)(F)F)n1)B(O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(2-Tetrahydropyranyl)-3-(trifluoromethyl)-1H-pyrazole-5-boronic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H12BF3N2O3Purity:95%Color and Shape:Crystals or powder or crystalline powder and/or chunks, White to yellowMolecular weight:264.01Boronic acid, B-[1-(tetrahydro-2H-pyran-2-yl)-3-(trifluoromethyl)-1H-pyrazol-5-yl]-
CAS:Formula:C9H12BF3N2O3Purity:97%Color and Shape:SolidMolecular weight:264.00941-(Tetrahydropyran-2-yl)-3-(trifluoromethyl)pyrazole-5-boronic acid
CAS:1-(Tetrahydropyran-2-yl)-3-(trifluoromethyl)pyrazole-5-boronic acidPurity:≥95%Color and Shape:SolidMolecular weight:264.01g/mol(1-(Tetrahydro-2H-pyran-2-yl)-3-(trifluoromethyl)-1H-pyrazol-5-yl)boronic acid
CAS:Formula:C9H12BF3N2O3Purity:97%Molecular weight:264.01



