CAS 1141889-24-8

B-[1-(2-Aminoethyl)-1H-pyrazol-4-yl]boronic acid

Description:

B-[1-(2-Aminoethyl)-1H-pyrazol-4-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a pyrazole ring. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The aminoethyl substituent enhances its solubility in polar solvents and may contribute to its biological activity. The pyrazole moiety can participate in hydrogen bonding and may influence the compound's reactivity and interaction with biological targets. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are vital in organic synthesis for forming carbon-carbon bonds. Overall, B-[1-(2-Aminoethyl)-1H-pyrazol-4-yl]boronic acid is a versatile compound with potential applications in drug development and synthetic chemistry, owing to its unique structural features and reactivity.

Formula: C₅H₁₀BN₃O₂

InChI: InChI=1S/C5H10BN3O2/c7-1-2-9-4-5(3-8-9)6(10)11/h3-4,10-11H,1-2,7H2

InChI key: InChIKey=HVUKTKFOMIASCJ-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CN(CCN)N=C1

Synonyms:

• Boronic acid, B-[1-(2-aminoethyl)-1H-pyrazol-4-yl]-
• B-[1-(2-Aminoethyl)-1H-pyrazol-4-yl]boronic acid
• (1-(2-Aminoethyl)-1H-pyrazol-4-yl)boronic acid
• 1-(2-Aminoethyl)-1H-pyrazol-4-ylboronic acid

(1-(2-Aminoethyl)-1H-pyrazol-4-yl)boronic acid

CAS: 1141889-24-8

Formula: C₅H₁₀BN₃O₂

Molecular weight: 154.9628

Ref: IN-DA000AQW