
CAS 114192-10-8
:3-Oxo-2-(1-oxopropyl)-4-nonynoic acid
Description:
3-Oxo-2-(1-oxopropyl)-4-nonynoic acid, with the CAS number 114192-10-8, is an organic compound characterized by its unique structure, which includes a nonynoyl chain and multiple functional groups. This compound features a ketone group (3-oxo) and a carboxylic acid group, contributing to its reactivity and potential applications in organic synthesis. The presence of the nonynoyl chain indicates that it is an alkyne derivative, which can participate in various chemical reactions, including addition and substitution reactions. The compound's molecular structure suggests it may exhibit properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and materials science. Additionally, the presence of multiple functional groups allows for further derivatization, which can enhance its utility in various chemical applications. Overall, 3-Oxo-2-(1-oxopropyl)-4-nonynoic acid is a versatile compound with potential implications in research and industry.
Formula:C12H16O4
InChI:InChI=1S/C12H16O4/c1-3-5-6-7-8-10(14)11(12(15)16)9(13)4-2/h11H,3-6H2,1-2H3,(H,15,16)
InChI key:InChIKey=SYSSEVYNJZFAIL-UHFFFAOYSA-N
SMILES:C(C(C#CCCCC)=O)(C(CC)=O)C(O)=O
Synonyms:- 4-Nonynoic acid, 3-oxo-2-(1-oxopropyl)-
- 3-Oxo-2-(1-oxopropyl)-4-nonynoic acid
- 3-Oxo-2-propanoylnon-4-ynoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
