
CAS 114195-62-9
:D-Glutamic acid, N-acetyl-, dimethyl ester
Description:
D-Glutamic acid, N-acetyl-, dimethyl ester, with the CAS number 114195-62-9, is a synthetic derivative of glutamic acid, an amino acid that plays a crucial role in various biological processes. This compound features an N-acetyl group and two methyl ester groups, which enhance its solubility and stability compared to its parent amino acid. It is typically a white to off-white solid and is soluble in polar solvents such as water and methanol. The presence of the acetyl and methyl ester functionalities suggests that it may exhibit different reactivity and biological activity compared to free D-glutamic acid. This compound is often used in biochemical research, particularly in studies involving neurotransmission and metabolic pathways, due to its structural similarity to naturally occurring amino acids. Additionally, it may serve as a building block in the synthesis of more complex molecules in pharmaceutical and chemical research. As with many chemical substances, proper handling and safety precautions are essential to mitigate any potential hazards associated with its use.
Formula:C9H15NO5
InChI:InChI=1S/C9H15NO5/c1-6(11)10-7(9(13)15-3)4-5-8(12)14-2/h7H,4-5H2,1-3H3,(H,10,11)/t7-/m1/s1
InChI key:InChIKey=KAUXXCKARJMDIG-SSDOTTSWSA-N
SMILES:[C@H](C(OC)=O)(CCC(OC)=O)NC(C)=O
Synonyms:- 1,5-Dimethyl (2R)-2-acetamidopentanedioate
- D-Glutamic acid, N-acetyl-, dimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
