CAS 1142-29-6
:4-[(prop-2-en-1-ylcarbamothioyl)amino]benzoic acid
Description:
4-[(Prop-2-en-1-ylcarbamothioyl)amino]benzoic acid, with the CAS number 1142-29-6, is an organic compound characterized by its functional groups and structural features. It contains an amino group, a carboxylic acid group, and a thioamide moiety, which contribute to its reactivity and potential biological activity. The presence of the prop-2-en-1-yl group indicates that it has an alkene functionality, which can participate in various chemical reactions, such as polymerization or addition reactions. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while its aromatic ring may provide some hydrophobic character. The thioamide group can influence the compound's interaction with biological systems, potentially affecting its pharmacological properties. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C11H12N2O2S
InChI:InChI=1/C11H12N2O2S/c1-2-7-12-11(16)13-9-5-3-8(4-6-9)10(14)15/h2-6H,1,7H2,(H,14,15)(H2,12,13,16)
SMILES:C=CCN=C(Nc1ccc(cc1)C(=O)O)S
Synonyms:- 4-[(Allylcarbamothioyl)amino]benzoic acid
- Benzoic Acid, 4-[[(2-Propen-1-Ylamino)Thioxomethyl]Amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
