
CAS 1142-43-4
:3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, phosphate (salt)
Description:
3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, phosphate (salt), with the CAS number 1142-43-4, is a chemical compound that features a pyridine ring substituted with hydroxymethyl and methyl groups, along with a phosphate moiety. This compound is typically characterized by its solubility in water due to the presence of the phosphate group, which enhances its ionic nature. It may exhibit biological activity, potentially acting as a biochemical agent or a precursor in various synthetic pathways. The presence of hydroxyl groups suggests it could participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the methyl group may affect its steric properties and overall stability. As a salt, it may exist in various forms depending on the counterion associated with the phosphate group. Overall, this compound's unique structure and functional groups contribute to its potential applications in pharmaceuticals, biochemistry, and materials science.
Formula:C8H11NO3·xH3O4P
InChI:InChI=1S/C8H11NO3.H3O4P/c1-5-8(12)7(4-11)6(3-10)2-9-5;1-5(2,3)4/h2,10-12H,3-4H2,1H3;(H3,1,2,3,4)
InChI key:InChIKey=IPGWPDHPOQYBMR-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)O.C(O)C=1C(CO)=CN=C(C)C1O
Synonyms:- 3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, phosphate (salt)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,4-Pyridinedimethanol, 5-hydroxy-6-methyl-, phosphate (salt) (9CI)
CAS:Formula:C8H14NO7PMolecular weight:267.173
