
CAS 1142-85-4
:1-Methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl 3-methylbutanoate
Description:
1-Methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl 3-methylbutanoate, with CAS number 1142-85-4, is an organic compound that belongs to the class of esters. It is characterized by its complex structure, which includes a cyclohexene ring and multiple alkyl groups. This compound typically exhibits a pleasant, fruity aroma, making it of interest in the flavor and fragrance industry. Its molecular structure suggests it may have moderate volatility and solubility in organic solvents, while being less soluble in water due to its hydrophobic characteristics. The presence of multiple methyl groups contributes to its steric hindrance, potentially influencing its reactivity and interaction with other molecules. Additionally, like many esters, it may undergo hydrolysis in the presence of water, leading to the formation of the corresponding alcohol and acid. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C15H26O2
InChI:InChI=1S/C15H26O2/c1-11(2)10-14(16)17-15(4,5)13-8-6-12(3)7-9-13/h6,11,13H,7-10H2,1-5H3
InChI key:InChIKey=XRADSECIALQFFY-UHFFFAOYSA-N
SMILES:C(OC(CC(C)C)=O)(C)(C)C1CCC(C)=CC1
Synonyms:- 2-(4-Methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate
- Butanoic acid, 3-methyl-, 1-methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl ester
- Isovaleric acid, p-menth-1-en-8-yl ester
- 1-Methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl 3-methylbutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanoic acid, 3-methyl-, 1-methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl ester
CAS:Formula:C15H26O2Molecular weight:238.3657
