CAS 114214-50-5

1,1-Dimethylethyl 3-hydroxy-4-methoxy-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-hydroxy-4-methoxy-1-pyrrolidinecarboxylate, identified by its CAS number 114214-50-5, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This substance is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and functional groups including a hydroxy group and a methoxy group, contributing to its potential reactivity and solubility properties. The hydroxy group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the methoxy group may influence its electronic properties and steric hindrance. The compound's structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrrolidine moiety, which is often associated with bioactive compounds. Additionally, its unique combination of substituents may impart specific biological activities, making it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₀H₁₉NO₄

InChI: InChI=1S/C10H19NO4/c1-10(2,3)15-9(13)11-5-7(12)8(6-11)14-4/h7-8,12H,5-6H2,1-4H3

InChI key: InChIKey=XAJCELXHUNUFBB-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(OC)C(O)C1

Synonyms:

• 1,1-Dimethylethyl 3-hydroxy-4-methoxy-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 3-hydroxy-4-methoxy-, 1,1-dimethylethyl ester