CymitQuimica logo

CAS 1142191-55-6

:

4-Formyl-5-methoxy-N-phenyl-3-pyridinecarboxamide

Description:
4-Formyl-5-methoxy-N-phenyl-3-pyridinecarboxamide is a chemical compound characterized by its unique structural features, which include a pyridine ring, an aldehyde functional group, and a methoxy group. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and oxidation. The methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. The N-phenyl substitution suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological activities would depend on further empirical studies. Its molecular structure allows for potential applications in drug development and organic synthesis. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C14H12N2O3
InChI:InChI=1S/C14H12N2O3/c1-19-13-8-15-7-11(12(13)9-17)14(18)16-10-5-3-2-4-6-10/h2-9H,1H3,(H,16,18)
InChI key:InChIKey=SXUZGAOQOYOTIT-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C=2C(C=O)=C(OC)C=NC2
Synonyms:
  • 3-Pyridinecarboxamide, 4-formyl-5-methoxy-N-phenyl-
  • 4-Formyl-5-methoxy-N-phenyl-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.