CAS 1142191-65-8
:4-Methoxy-3-[2-(trimethylsilyl)ethynyl]-2-pyridinamine
Description:
4-Methoxy-3-[2-(trimethylsilyl)ethynyl]-2-pyridinamine is an organic compound characterized by its pyridine ring, which is substituted with a methoxy group and an ethynyl group that is further modified by a trimethylsilyl group. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The trimethylsilyl group provides stability and can enhance the compound's lipophilicity, making it useful in various synthetic applications. This compound may exhibit interesting electronic properties due to the conjugation between the ethynyl and pyridine moieties, potentially leading to applications in organic electronics or as a building block in medicinal chemistry. Additionally, the presence of the amino group suggests potential for hydrogen bonding and reactivity in further chemical transformations. Overall, this compound's unique structural features make it a candidate for research in fields such as pharmaceuticals, materials science, and organic synthesis.
Formula:C11H16N2OSi
InChI:InChI=1S/C11H16N2OSi/c1-14-10-5-7-13-11(12)9(10)6-8-15(2,3)4/h5,7H,1-4H3,(H2,12,13)
InChI key:InChIKey=YMEMZSDPPMVKEZ-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C=1C(OC)=CC=NC1N
Synonyms:- 4-Methoxy-3-[2-(trimethylsilyl)ethynyl]-2-pyridinamine
- 2-Pyridinamine, 4-methoxy-3-[2-(trimethylsilyl)ethynyl]-
- 4-Methoxy-3-((trimethylsilyl)ethynyl)pyridin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.