CymitQuimica logo

CAS 1142191-73-8

:

Methyl 3-(2-chloro-4-iodo-3-pyridinyl)-2-propenoate

Description:
Methyl 3-(2-chloro-4-iodo-3-pyridinyl)-2-propenoate is an organic compound characterized by its unique structure, which includes a methyl ester functional group and a pyridine ring substituted with chlorine and iodine atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. The presence of halogen substituents (chlorine and iodine) on the pyridine ring can influence its reactivity and biological activity, making it a subject of interest in drug development. Additionally, the propenoate moiety contributes to its reactivity, allowing for further chemical transformations. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C9H7ClINO2
InChI:InChI=1S/C9H7ClINO2/c1-14-8(13)3-2-6-7(11)4-5-12-9(6)10/h2-5H,1H3
InChI key:InChIKey=PFURSIHBCIIRFW-UHFFFAOYSA-N
SMILES:C(=CC(OC)=O)C=1C(I)=CC=NC1Cl
Synonyms:
  • Methyl 3-(2-chloro-4-iodo-3-pyridinyl)-2-propenoate
  • 2-Propenoic acid, 3-(2-chloro-4-iodo-3-pyridinyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.