CAS 1142191-74-9
:N-[2-Chloro-6-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide
Description:
N-[2-Chloro-6-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a chlorine atom and a trimethylsilyl group. The presence of the dimethylpropanamide moiety contributes to its amide functionality, which can influence its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the combination of its aromatic and aliphatic components. The trimethylsilyl group may enhance its stability and lipophilicity, potentially affecting its biological activity and interactions. As a pyridine derivative, it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The chlorine substituent can also impart specific electronic properties, making it a candidate for applications in medicinal chemistry or as a synthetic intermediate. Overall, the compound's characteristics suggest potential utility in research and development, particularly in fields related to pharmaceuticals or agrochemicals.
Formula:C13H21ClN2OSi
InChI:InChI=1S/C13H21ClN2OSi/c1-13(2,3)12(17)15-9-7-8-10(16-11(9)14)18(4,5)6/h7-8H,1-6H3,(H,15,17)
InChI key:InChIKey=ZQGZINJHCZYAJD-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(Cl)N=C([Si](C)(C)C)C=C1
Synonyms:- Propanamide, N-[2-chloro-6-(trimethylsilyl)-3-pyridinyl]-2,2-dimethyl-
- N-[2-Chloro-6-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.