CAS 1142191-77-2
:N-[2-Chloro-6-(2-propen-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide
Description:
N-[2-Chloro-6-(2-propen-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide, identified by its CAS number 1142191-77-2, is a chemical compound characterized by its unique structural features, including a pyridine ring substituted with a chlorine atom and a propenyl group. This compound belongs to the class of amides, which are characterized by the presence of a carbonyl group (C=O) directly attached to a nitrogen atom (N). The presence of the 2,2-dimethylpropanamide moiety contributes to its steric bulk, potentially influencing its biological activity and solubility. The chlorinated pyridine structure may impart specific reactivity and interaction properties, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the compound's molecular structure suggests potential for various interactions with biological targets, which could be explored for therapeutic purposes. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for practical applications.
Formula:C13H17ClN2O
InChI:InChI=1S/C13H17ClN2O/c1-5-6-9-7-8-10(11(14)15-9)16-12(17)13(2,3)4/h5,7-8H,1,6H2,2-4H3,(H,16,17)
InChI key:InChIKey=MCARBAQGMMBQKC-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(Cl)N=C(CC=C)C=C1
Synonyms:- Propanamide, N-[2-chloro-6-(2-propen-1-yl)-3-pyridinyl]-2,2-dimethyl-
- N-[2-Chloro-6-(2-propen-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.