CAS 1142191-79-4

1,1-Dimethylethyl N-[(4,5-dimethoxy-3-pyridinyl)methyl]carbamate

Description:

1,1-Dimethylethyl N-[(4,5-dimethoxy-3-pyridinyl)methyl]carbamate, identified by its CAS number 1142191-79-4, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethylated tert-butyl group and a pyridine ring substituted with methoxy groups. The presence of the carbamate functional group indicates potential applications in agriculture, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. The methoxy substituents on the pyridine ring may enhance its lipophilicity and biological activity, making it more effective in target interactions. Additionally, the compound's stability and solubility characteristics can be influenced by the steric effects of the tert-butyl group and the electronic effects of the methoxy groups. Overall, this compound's unique structural features suggest it may have significant utility in various chemical and biological applications, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₃H₂₀N₂O₄

InChI: InChI=1S/C13H20N2O4/c1-13(2,3)19-12(16)15-7-9-6-14-8-10(17-4)11(9)18-5/h6,8H,7H2,1-5H3,(H,15,16)

InChI key: InChIKey=QLZIMMWYZWGOFP-UHFFFAOYSA-N

SMILES: O(C)C=1C(CNC(OC(C)(C)C)=O)=CN=CC1OC

Synonyms:

• Carbamic acid, N-[(4,5-dimethoxy-3-pyridinyl)methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[(4,5-dimethoxy-3-pyridinyl)methyl]carbamate

tert-Butyl (4,5-dimethoxypyridin-3-yl)-methylcarbamate

CAS: 1142191-79-4

Formula: C₁₃H₂₀N₂O₄

Molecular weight: 268.3089

Ref: IN-DA000AUR