CAS 1142191-82-9

6-Bromo-2-chloro-3-(2-propen-1-yl)pyridine

Description:

6-Bromo-2-chloro-3-(2-propen-1-yl)pyridine is an organic compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with both bromine and chlorine atoms, as well as a propenyl group. The presence of these substituents contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of more complex molecules. The bromine and chlorine atoms introduce electrophilic characteristics, making the compound useful in nucleophilic substitution reactions. Additionally, the propenyl group can participate in further reactions such as polymerization or addition reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemicals. Its physical properties, such as solubility and boiling point, are influenced by the functional groups and the overall molecular structure. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-Bromo-2-chloro-3-(2-propen-1-yl)pyridine is a versatile compound with potential applications in various fields of chemistry.

Formula: C₈H₇BrClN

InChI: InChI=1S/C8H7BrClN/c1-2-3-6-4-5-7(9)11-8(6)10/h2,4-5H,1,3H2

InChI key: InChIKey=CUWURFDLPNVNQR-UHFFFAOYSA-N

SMILES: C(C=C)C1=C(Cl)N=C(Br)C=C1

Synonyms:

• 6-Bromo-2-chloro-3-(2-propen-1-yl)pyridine
• Pyridine, 6-bromo-2-chloro-3-(2-propen-1-yl)-
• 3-Allyl-6-bromo-2-chloropyridine