CAS 1142191-83-0

6-Chloro-5-[(2,2-dimethyl-1-oxopropyl)amino]-2-pyridinecarboxylic acid

Description:

6-Chloro-5-[(2,2-dimethyl-1-oxopropyl)amino]-2-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring, which is substituted at the 6-position with a chlorine atom and at the 5-position with an amino group linked to a 2,2-dimethyl-1-oxopropyl moiety. This structure suggests that the compound may exhibit both acidic and basic properties due to the presence of the carboxylic acid group and the amino group, respectively. The chlorine substituent can influence the compound's reactivity and solubility, potentially enhancing its biological activity. The presence of the bulky dimethyl group may affect steric hindrance, influencing interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its specific properties, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. Further investigation would be necessary to fully understand its applications and behavior in various chemical contexts.

Formula: C₁₁H₁₃ClN₂O₃

InChI: InChI=1S/C11H13ClN2O3/c1-11(2,3)10(17)14-6-4-5-7(9(15)16)13-8(6)12/h4-5H,1-3H3,(H,14,17)(H,15,16)

InChI key: InChIKey=LZPRASZVDWUTNR-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C(Cl)N=C(C(O)=O)C=C1

Synonyms:

• 6-Chloro-5-[(2,2-dimethyl-1-oxopropyl)amino]-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 6-chloro-5-[(2,2-dimethyl-1-oxopropyl)amino]-

6-Chloro-5-pivalamidopicolinic acid

CAS: 1142191-83-0

Formula: C₁₁H₁₃ClN₂O₃

Molecular weight: 256.6855

Ref: IN-DA0090VH