CAS 1142191-85-2

6-Bromo-2-chloro-3-(trimethylsilyl)pyridine

Description:

6-Bromo-2-chloro-3-(trimethylsilyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and chlorine substituents at the 6 and 2 positions, respectively, introduces significant reactivity and influences its chemical properties. The trimethylsilyl group at the 3-position enhances the compound's stability and solubility in organic solvents, making it useful in various synthetic applications. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, due to its ability to participate in nucleophilic substitution reactions. Its unique combination of halogen and silyl groups allows for selective functionalization, making it valuable in medicinal chemistry and materials science. Additionally, the presence of the nitrogen atom in the pyridine ring contributes to its basicity and potential interactions with other chemical species. Overall, 6-Bromo-2-chloro-3-(trimethylsilyl)pyridine is a versatile compound with applications in various fields of chemistry.

Formula: C₈H₁₁BrClNSi

InChI: InChI=1S/C8H11BrClNSi/c1-12(2,3)6-4-5-7(9)11-8(6)10/h4-5H,1-3H3

InChI key: InChIKey=KFYYIXMSPIHUDT-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C1=C(Cl)N=C(Br)C=C1