CAS 1142191-88-5

N-[2-Chloro-6-[(hydroxyimino)methyl]-3-pyridinyl]-2,2-dimethylpropanamide

Description:

N-[2-Chloro-6-[(hydroxyimino)methyl]-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro group and a hydroxyimino side chain. This compound features a dimethylpropanamide moiety, contributing to its amide functional group characteristics. The presence of the hydroxyimino group suggests potential reactivity, particularly in forming oximes or participating in condensation reactions. The chloro substituent may influence the compound's reactivity and solubility, while the pyridine ring can contribute to its aromatic properties and potential biological activity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could interact with biological targets. Its specific properties, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₁H₁₄ClN₃O₂

InChI: InChI=1S/C11H14ClN3O2/c1-11(2,3)10(16)15-8-5-4-7(6-13-17)14-9(8)12/h4-6,17H,1-3H3,(H,15,16)

InChI key: InChIKey=AMTBFOGWMWANQE-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C(Cl)N=C(C=NO)C=C1

Synonyms:

• Propanamide, N-[2-chloro-6-[(hydroxyimino)methyl]-3-pyridinyl]-2,2-dimethyl-
• N-[2-Chloro-6-[(hydroxyimino)methyl]-3-pyridinyl]-2,2-dimethylpropanamide