CAS 1142192-04-8
:N-[2-Chloro-6-(3-hydroxy-1-propyn-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide
Description:
N-[2-Chloro-6-(3-hydroxy-1-propyn-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chlorine atom and a propynyl group featuring a hydroxyl functional group. This compound is classified as an amide due to the presence of the amide functional group (-C(=O)N-). The presence of the chlorine atom and the hydroxyl group contributes to its potential reactivity and solubility properties. The compound's molecular structure suggests it may exhibit biological activity, possibly as a pharmaceutical agent, given its specific functional groups that can interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as chromatography. Safety data sheets would be essential for handling this compound, as it may pose health risks due to its chemical nature. Overall, this compound represents a unique structure that could be of interest in medicinal chemistry and related fields.
Formula:C13H15ClN2O2
InChI:InChI=1S/C13H15ClN2O2/c1-13(2,3)12(18)16-10-7-6-9(5-4-8-17)15-11(10)14/h6-7,17H,8H2,1-3H3,(H,16,18)
InChI key:InChIKey=WWRUIOPEMGVHOR-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(Cl)N=C(C#CCO)C=C1
Synonyms:- N-[2-Chloro-6-(3-hydroxy-1-propyn-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide
- Propanamide, N-[2-chloro-6-(3-hydroxy-1-propyn-1-yl)-3-pyridinyl]-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2-Chloro-6-(3-hydroxyprop-1-ynyl)pyridin-3-yl)-pivalamide
CAS:Formula:C13H15ClN2O2Molecular weight:266.7234
