CAS 1142192-09-3

1,1-Dimethylethyl N-[6-chloro-5-[(2,2-dimethyl-1-oxopropyl)amino]-2-pyridinyl]carbamate

Description:

1,1-Dimethylethyl N-[6-chloro-5-[(2,2-dimethyl-1-oxopropyl)amino]-2-pyridinyl]carbamate, identified by its CAS number 1142192-09-3, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a pyridine ring, which is substituted with a chloro group and an amino group linked to a dimethyl-1-oxopropyl moiety. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, potentially influencing its biological activity and solubility properties. The compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in various fields, including agriculture and pharmaceuticals. As with many chemical substances, safety data and handling precautions are essential, given the potential for toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications.

Formula: C₁₅H₂₂ClN₃O₃

InChI: InChI=1S/C15H22ClN3O3/c1-14(2,3)12(20)17-9-7-8-10(18-11(9)16)19-13(21)22-15(4,5)6/h7-8H,1-6H3,(H,17,20)(H,18,19,21)

InChI key: InChIKey=GMQIMSAHJLTCOX-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C1=C(Cl)N=C(NC(OC(C)(C)C)=O)C=C1

Synonyms:

• Carbamic acid, N-[6-chloro-5-[(2,2-dimethyl-1-oxopropyl)amino]-2-pyridinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[6-chloro-5-[(2,2-dimethyl-1-oxopropyl)amino]-2-pyridinyl]carbamate