CymitQuimica logo

CAS 1142192-13-9

:

2-Chloro-4-iodo-3-(2-propen-1-yl)pyridine

Description:
2-Chloro-4-iodo-3-(2-propen-1-yl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of chlorine and iodine substituents at the 2 and 4 positions, respectively, introduces significant reactivity and influences the compound's physical and chemical properties. The 3-position features a propenyl group, which contributes to its potential as a building block in organic synthesis and medicinal chemistry. This compound may exhibit properties such as moderate solubility in organic solvents and varying stability under different conditions, influenced by the halogen substituents. Its reactivity can be attributed to the electrophilic nature of the halogens, making it suitable for further functionalization. Additionally, the presence of the nitrogen atom in the pyridine ring can impart basicity and potential coordination with metal ions. Overall, 2-Chloro-4-iodo-3-(2-propen-1-yl)pyridine is a versatile compound with applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H7ClIN
InChI:InChI=1S/C8H7ClIN/c1-2-3-6-7(10)4-5-11-8(6)9/h2,4-5H,1,3H2
InChI key:InChIKey=XBNJCPXJPFDTDG-UHFFFAOYSA-N
SMILES:C(C=C)C=1C(I)=CC=NC1Cl
Synonyms:
  • 2-Chloro-4-iodo-3-(2-propen-1-yl)pyridine
  • Pyridine, 2-chloro-4-iodo-3-(2-propen-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.