CAS 1142192-17-3

Methyl 3-cyano-5-methoxy-4-pyridinecarboxylate

Description:

Methyl 3-cyano-5-methoxy-4-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the cyano group (-CN) and the methoxy group (-OCH3) contributes to its chemical reactivity and polarity. This compound typically exhibits moderate solubility in polar organic solvents due to the presence of functional groups that can engage in hydrogen bonding and dipole interactions. It may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it of interest in synthetic organic chemistry. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of biologically active molecules. Additionally, its unique combination of functional groups may impart specific properties, such as enhanced lipophilicity or bioactivity, which are valuable in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₈N₂O₃

InChI: InChI=1S/C9H8N2O3/c1-13-7-5-11-4-6(3-10)8(7)9(12)14-2/h4-5H,1-2H3

InChI key: InChIKey=CSOQJJMRYXTKLS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(C#N)=CN=CC1OC

Synonyms:

• Methyl 3-cyano-5-methoxy-4-pyridinecarboxylate
• 4-Pyridinecarboxylic acid, 3-cyano-5-methoxy-, methyl ester