CAS 1142192-25-3

6-Bromo-2-chloro-3-pyridinecarboxaldehyde oxime

Description:

6-Bromo-2-chloro-3-pyridinecarboxaldehyde oxime is a chemical compound characterized by its unique functional groups and structural features. It contains a pyridine ring, which is a six-membered aromatic heterocycle with nitrogen, and is substituted with both bromine and chlorine atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of the aldehyde functional group, along with the oxime moiety, indicates that this compound can participate in various chemical reactions, such as condensation and nucleophilic addition. Its molecular structure suggests that it may exhibit specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as solubility, melting point, and stability, can be influenced by the halogen substituents and the oxime configuration. Overall, 6-Bromo-2-chloro-3-pyridinecarboxaldehyde oxime is a versatile compound that may serve as an intermediate in the synthesis of more complex molecules or as a potential lead in drug discovery.

Formula: C₆H₄BrClN₂O

InChI: InChI=1S/C6H4BrClN2O/c7-5-2-1-4(3-9-11)6(8)10-5/h1-3,11H

InChI key: InChIKey=SQQIXMTXOUWODS-UHFFFAOYSA-N

SMILES: C(=NO)C1=C(Cl)N=C(Br)C=C1

Synonyms:

• 6-Bromo-2-chloro-3-pyridinecarboxaldehyde oxime
• 3-Pyridinecarboxaldehyde, 6-bromo-2-chloro-, oxime