CAS 1142192-26-4
:2,5-Dibromo-3-pyridinyl 1,1-dimethylethyl carbonate
Description:
2,5-Dibromo-3-pyridinyl 1,1-dimethylethyl carbonate is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with bromine atoms and a carbonate functional group. The presence of bromine enhances its reactivity and potential applications in various chemical reactions, particularly in organic synthesis. The carbonate moiety contributes to its stability and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential uses in agrochemicals or as an intermediate in the synthesis of more complex molecules. Additionally, the presence of the dimethylethyl group may influence its steric properties and overall reactivity. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 2,5-Dibromo-3-pyridinyl 1,1-dimethylethyl carbonate is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H11Br2NO3
InChI:InChI=1S/C10H11Br2NO3/c1-10(2,3)16-9(14)15-7-4-6(11)5-13-8(7)12/h4-5H,1-3H3
InChI key:InChIKey=NVLDYYOQPLJWIQ-UHFFFAOYSA-N
SMILES:O(C(OC(C)(C)C)=O)C1=C(Br)N=CC(Br)=C1
Synonyms:- tert-Butyl 2,5-dibromopyridin-3-yl carbonate
- 2,5-Dibromo-3-pyridinyl 1,1-dimethylethyl carbonate
- Carbonic acid, 2,5-dibromo-3-pyridinyl 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.