CAS 1142192-30-0
:N-(2-Bromo-5-hydroxy-3-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(2-Bromo-5-hydroxy-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a bromine atom and a hydroxyl group, as well as a branched amide functional group. The presence of the bromine atom contributes to its potential reactivity, while the hydroxyl group may impart hydrogen bonding capabilities, influencing its solubility and interaction with biological systems. The dimethylpropanamide moiety suggests that the compound may exhibit lipophilic properties, which can affect its pharmacokinetics if considered for medicinal applications. This compound may be of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activity. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or referenced from chemical databases. Overall, the combination of functional groups in this compound suggests a complex behavior that could be explored in further research.
Formula:C10H13BrN2O2
InChI:InChI=1S/C10H13BrN2O2/c1-10(2,3)9(15)13-7-4-6(14)5-12-8(7)11/h4-5,14H,1-3H3,(H,13,15)
InChI key:InChIKey=BSINMXALNIHGOQ-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(Br)N=CC(O)=C1
Synonyms:- Propanamide, N-(2-bromo-5-hydroxy-3-pyridinyl)-2,2-dimethyl-
- N-(2-Bromo-5-hydroxy-3-pyridinyl)-2,2-dimethylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
