CAS 1142192-31-1

6-Bromo-5-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid

Description:

6-Bromo-5-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and a carboxylic acid group. The presence of the amino group linked to a 2,2-dimethyl-1-oxopropyl moiety contributes to its potential biological activity. This compound may exhibit properties typical of pyridine derivatives, such as being a weak base due to the nitrogen atom in the ring. Its carboxylic acid functionality can participate in hydrogen bonding and may influence solubility and reactivity in various solvents. The bromine substituent can enhance lipophilicity and may also play a role in the compound's interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₁H₁₃BrN₂O₃

InChI: InChI=1S/C11H13BrN2O3/c1-11(2,3)10(17)14-7-4-6(9(15)16)5-13-8(7)12/h4-5H,1-3H3,(H,14,17)(H,15,16)

InChI key: InChIKey=RYFWGNXFVJHQTO-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C=1C=C(C(O)=O)C=NC1Br

Synonyms:

• 6-Bromo-5-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 6-bromo-5-[(2,2-dimethyl-1-oxopropyl)amino]-