CAS 1142192-34-4
:N-(2-Bromo-5-formyl-3-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(2-Bromo-5-formyl-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a bromine atom and an aldehyde group. The presence of the 2,2-dimethylpropanamide moiety contributes to its amide functionality, which is known for its stability and ability to participate in hydrogen bonding. This compound may exhibit biological activity due to the presence of the pyridine ring, which is often associated with various pharmacological properties. The bromine substituent can enhance the lipophilicity and reactivity of the molecule, potentially influencing its interaction with biological targets. Additionally, the aldehyde group may participate in further chemical reactions, such as condensation or reduction. Overall, the compound's characteristics suggest potential applications in medicinal chemistry and organic synthesis, although specific biological activities and applications would require further investigation through experimental studies.
Formula:C11H13BrN2O2
InChI:InChI=1S/C11H13BrN2O2/c1-11(2,3)10(16)14-8-4-7(6-15)5-13-9(8)12/h4-6H,1-3H3,(H,14,16)
InChI key:InChIKey=GNGDIUMPJFTUSP-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C=C(C=O)C=NC1Br
Synonyms:- N-(2-Bromo-5-formyl-3-pyridinyl)-2,2-dimethylpropanamide
- Propanamide, N-(2-bromo-5-formyl-3-pyridinyl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
