CymitQuimica logo

CAS 1142192-40-2

:

1,1-Dimethylethyl 2-iodo-6-[2-(trimethylsilyl)ethynyl]-3-pyridinyl carbonate

Description:
1,1-Dimethylethyl 2-iodo-6-[2-(trimethylsilyl)ethynyl]-3-pyridinyl carbonate, identified by its CAS number 1142192-40-2, is a chemical compound that features a complex structure incorporating a pyridine ring, an iodinated substituent, and a carbonate functional group. The presence of the trimethylsilyl group suggests that the compound may exhibit enhanced stability and solubility in organic solvents, making it useful in various synthetic applications. The iodide substituent can serve as a potential leaving group in nucleophilic substitution reactions, while the ethynyl group may participate in further coupling reactions, expanding its utility in organic synthesis. Additionally, the dimethyl group contributes to steric hindrance, which can influence the reactivity and selectivity of the compound in chemical reactions. Overall, this compound's unique structural features make it a valuable intermediate in the synthesis of more complex organic molecules, particularly in medicinal chemistry and materials science.
Formula:C15H20INO3Si
InChI:InChI=1S/C15H20INO3Si/c1-15(2,3)20-14(18)19-12-8-7-11(17-13(12)16)9-10-21(4,5)6/h7-8H,1-6H3
InChI key:InChIKey=GQCXQIDDGFOWAC-UHFFFAOYSA-N
SMILES:O(C(OC(C)(C)C)=O)C1=C(I)N=C(C#C[Si](C)(C)C)C=C1
Synonyms:
  • 1,1-Dimethylethyl 2-iodo-6-[2-(trimethylsilyl)ethynyl]-3-pyridinyl carbonate
  • Carbonic acid, 1,1-dimethylethyl 2-iodo-6-[2-(trimethylsilyl)ethynyl]-3-pyridinyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.